C9H4BrCl2F5 — CID 130236766
5-(1-bromo-2,2,2-trifluoroethyl)-1,3-dichloro-2-(difluoromethyl)benzene (PubChem CID 130236766) has the molecular formula C9H4BrCl2F5 and a molecular weight of 357.93 g/mol. Its IUPAC name is 5-(1-bromo-2,2,2-trifluoroethyl)-1,3-dichloro-2-(difluoromethyl)benzene.
| Compound Name | 5-(1-bromo-2,2,2-trifluoroethyl)-1,3-dichloro-2-(difluoromethyl)benzene |
|---|---|
| PubChem CID | 130236766 |
| Molecular Formula | C9H4BrCl2F5 |
| Molecular Weight | 357.93 g/mol |
| Exact Mass | 355.88 |
| IUPAC Name | 5-(1-bromo-2,2,2-trifluoroethyl)-1,3-dichloro-2-(difluoromethyl)benzene |
| SMILES | FC(F)c1c(Cl)cc(C(Br)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C9H4BrCl2F5/c10-7(9(15,16)17)3-1-4(11)6(8(13)14)5(12)2-3/h1-2,7-8H |
| InChIKey | QXJRRLREHKVOBZ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.93 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|