C9H7Br2F3 — CID 130132223
1-bromo-3-(1-bromo-2,2,2-trifluoroethyl)-5-methylbenzene (PubChem CID 130132223) has the molecular formula C9H7Br2F3 and a molecular weight of 331.96 g/mol. Its IUPAC name is 1-bromo-3-(1-bromo-2,2,2-trifluoroethyl)-5-methylbenzene.
| Compound Name | 1-bromo-3-(1-bromo-2,2,2-trifluoroethyl)-5-methylbenzene |
|---|---|
| PubChem CID | 130132223 |
| Molecular Formula | C9H7Br2F3 |
| Molecular Weight | 331.96 g/mol |
| Exact Mass | 329.89 |
| IUPAC Name | 1-bromo-3-(1-bromo-2,2,2-trifluoroethyl)-5-methylbenzene |
| SMILES | Cc1cc(Br)cc(C(Br)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H7Br2F3/c1-5-2-6(4-7(10)3-5)8(11)9(12,13)14/h2-4,8H,1H3 |
| InChIKey | LXSWOIWPNWEMMK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.96 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|