C19H31NO2 — CID 130237704
4-(diethylamino)-2-methyl-2-[4-(2-methylpropyl)phenyl]butanoic acid (PubChem CID 130237704) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 4-(diethylamino)-2-methyl-2-[4-(2-methylpropyl)phenyl]butanoic acid.
| Compound Name | 4-(diethylamino)-2-methyl-2-[4-(2-methylpropyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 130237704 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 4-(diethylamino)-2-methyl-2-[4-(2-methylpropyl)phenyl]butanoic acid |
| SMILES | CCN(CC)CCC(C)(C(=O)O)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C19H31NO2/c1-6-20(7-2)13-12-19(5,18(21)22)17-10-8-16(9-11-17)14-15(3)4/h8-11,15H,6-7,12-14H2,1-5H3,(H,21,22) |
| InChIKey | SSNUHSCCMLGWGP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |