C21H35NO4 — CID 175096043
acetic acid;ethyl 2-(diethylamino)-2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 175096043) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is acetic acid;ethyl 2-(diethylamino)-2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | acetic acid;ethyl 2-(diethylamino)-2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 175096043 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | acetic acid;ethyl 2-(diethylamino)-2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CC(=O)O.CCOC(=O)C(C)(c1ccc(CC(C)C)cc1)N(CC)CC |
| InChI | InChI=1S/C19H31NO2.C2H4O2/c1-7-20(8-2)19(6,18(21)22-9-3)17-12-10-16(11-13-17)14-15(4)5;1-2(3)4/h10-13,15H,7-9,14H2,1-6H3;1H3,(H,3,4) |
| InChIKey | AKIXBKZIAYKOGO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |