C38H46N2O3 — CID 70441498
ethyl 2-hydroxy-2,2-bis[4-[2-[[(1R)-1-phenylethyl]amino]propyl]phenyl]acetate (PubChem CID 70441498) has the molecular formula C38H46N2O3 and a molecular weight of 578.80 g/mol. Its IUPAC name is ethyl 2-hydroxy-2,2-bis[4-[2-[[(1R)-1-phenylethyl]amino]propyl]phenyl]acetate.
| Compound Name | ethyl 2-hydroxy-2,2-bis[4-[2-[[(1R)-1-phenylethyl]amino]propyl]phenyl]acetate |
|---|---|
| PubChem CID | 70441498 |
| Molecular Formula | C38H46N2O3 |
| Molecular Weight | 578.80 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | ethyl 2-hydroxy-2,2-bis[4-[2-[[(1R)-1-phenylethyl]amino]propyl]phenyl]acetate |
| SMILES | CCOC(=O)C(O)(c1ccc(CC(C)N[C@H](C)c2ccccc2)cc1)c1ccc(CC(C)N[C@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H46N2O3/c1-6-43-37(41)38(42,35-21-17-31(18-22-35)25-27(2)39-29(4)33-13-9-7-10-14-33)36-23-19-32(20-24-36)26-28(3)40-30(5)34-15-11-8-12-16-34/h7-24,27-30,39-40,42H,6,25-26H2,1-5H3/t27?,28?,29-,30-,38?/m1/s1 |
| InChIKey | MEZKABZZQJYLJD-ZXBBPXOTSA-N |
| XLogP | 7.05 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.80 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |