C10H19N — CID 13023821
(2E)-N,N-diethyl-4-methylpenta-2,4-dien-1-amine (PubChem CID 13023821) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (2E)-N,N-diethyl-4-methylpenta-2,4-dien-1-amine.
| Compound Name | (2E)-N,N-diethyl-4-methylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 13023821 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (2E)-N,N-diethyl-4-methylpenta-2,4-dien-1-amine |
| SMILES | C=C(C)/C=C/CN(CC)CC |
| InChI | InChI=1S/C10H19N/c1-5-11(6-2)9-7-8-10(3)4/h7-8H,3,5-6,9H2,1-2,4H3/b8-7+ |
| InChIKey | BHHZIZGFKQRXEL-BQYQJAHWSA-N |
| XLogP | 2.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|