C12H20O — CID 130238691
(1R)-2-(ethoxymethyl)tricyclo[3.3.1.03,7]nonane (PubChem CID 130238691) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (1R)-2-(ethoxymethyl)tricyclo[3.3.1.03,7]nonane.
| Compound Name | (1R)-2-(ethoxymethyl)tricyclo[3.3.1.03,7]nonane |
|---|---|
| PubChem CID | 130238691 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (1R)-2-(ethoxymethyl)tricyclo[3.3.1.03,7]nonane |
| SMILES | CCOCC1C2CC3CC2C[C@H]1C3 |
| InChI | InChI=1S/C12H20O/c1-2-13-7-12-10-4-8-3-9(6-10)11(12)5-8/h8-12H,2-7H2,1H3/t8?,9?,10-,11?,12?/m1/s1 |
| InChIKey | ZEIUFNQFGKDAHF-JWUQVZSFSA-N |
| XLogP | 2.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |