C24H37N3O5 — CID 130238753
N-(4-formyl-1-methoxypiperidin-4-yl)-N-(1-methoxypiperidin-4-yl)oxy-2-(2,4,6-trimethylphenyl)acetamide (PubChem CID 130238753) has the molecular formula C24H37N3O5 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-(4-formyl-1-methoxypiperidin-4-yl)-N-(1-methoxypiperidin-4-yl)oxy-2-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | N-(4-formyl-1-methoxypiperidin-4-yl)-N-(1-methoxypiperidin-4-yl)oxy-2-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 130238753 |
| Molecular Formula | C24H37N3O5 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | N-(4-formyl-1-methoxypiperidin-4-yl)-N-(1-methoxypiperidin-4-yl)oxy-2-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CON1CCC(ON(C(=O)Cc2c(C)cc(C)cc2C)C2(C=O)CCN(OC)CC2)CC1 |
| InChI | InChI=1S/C24H37N3O5/c1-18-14-19(2)22(20(3)15-18)16-23(29)27(32-21-6-10-25(30-4)11-7-21)24(17-28)8-12-26(31-5)13-9-24/h14-15,17,21H,6-13,16H2,1-5H3 |
| InChIKey | RYQZQKYYNSZURC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|