C48H54N2 — CID 130240799
1,9-dimethyl-9-N-(4-methylcyclohexa-1,5-dien-1-yl)-10-N-(4-methylphenyl)-9-N,10-N-diphenyl-3,7-di(propan-2-yl)-2,9a-dihydro-1H-anthracene-9,10-diamine (PubChem CID 130240799) has the molecular formula C48H54N2 and a molecular weight of 658.97 g/mol. Its IUPAC name is 1,9-dimethyl-9-N-(4-methylcyclohexa-1,5-dien-1-yl)-10-N-(4-methylphenyl)-9-N,10-N-diphenyl-3,7-di(propan-2-yl)-2,9a-dihydro-1H-anthracene-9,10-diamine.
| Compound Name | 1,9-dimethyl-9-N-(4-methylcyclohexa-1,5-dien-1-yl)-10-N-(4-methylphenyl)-9-N,10-N-diphenyl-3,7-di(propan-2-yl)-2,9a-dihydro-1H-anthracene-9,10-diamine |
|---|---|
| PubChem CID | 130240799 |
| Molecular Formula | C48H54N2 |
| Molecular Weight | 658.97 g/mol |
| Exact Mass | 658.43 |
| IUPAC Name | 1,9-dimethyl-9-N-(4-methylcyclohexa-1,5-dien-1-yl)-10-N-(4-methylphenyl)-9-N,10-N-diphenyl-3,7-di(propan-2-yl)-2,9a-dihydro-1H-anthracene-9,10-diamine |
| SMILES | Cc1ccc(N(C2=C3C=C(C(C)C)CC(C)C3C(C)(N(C3=CCC(C)C=C3)c3ccccc3)c3cc(C(C)C)ccc32)c2ccccc2)cc1 |
| InChI | InChI=1S/C48H54N2/c1-32(2)37-23-28-43-45(31-37)48(8,50(41-17-13-10-14-18-41)42-26-21-35(6)22-27-42)46-36(7)29-38(33(3)4)30-44(46)47(43)49(39-15-11-9-12-16-39)40-24-19-34(5)20-25-40/h9-21,23-28,30-33,35-36,46H,22,29H2,1-8H3 |
| InChIKey | MNNXAMNAKUUGFZ-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.97 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |