C10H22OSi — CID 13024088
cis-(1R,2R)-2-methyl-1-trimethylsilylcyclohexan-1-ol (PubChem CID 13024088) has the molecular formula C10H22OSi and a molecular weight of 186.37 g/mol. Its IUPAC name is cis-(1R,2R)-2-methyl-1-trimethylsilylcyclohexan-1-ol.
| Compound Name | cis-(1R,2R)-2-methyl-1-trimethylsilylcyclohexan-1-ol |
|---|---|
| PubChem CID | 13024088 |
| Molecular Formula | C10H22OSi |
| Molecular Weight | 186.37 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | cis-(1R,2R)-2-methyl-1-trimethylsilylcyclohexan-1-ol |
| SMILES | C[C@@H]1CCCC[C@@]1(O)[Si](C)(C)C |
| InChI | InChI=1S/C10H22OSi/c1-9-7-5-6-8-10(9,11)12(2,3)4/h9,11H,5-8H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | CGXFXIXWOAYTFY-NXEZZACHSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|