C15H32OSi — CID 134986664
1-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]methyl]cyclohexan-1-ol (PubChem CID 134986664) has the molecular formula C15H32OSi and a molecular weight of 256.51 g/mol. Its IUPAC name is 1-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 134986664 |
| Molecular Formula | C15H32OSi |
| Molecular Weight | 256.51 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 1-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]methyl]cyclohexan-1-ol |
| SMILES | CC(C)C(C)(C)[Si](C)(C)CC1(O)CCCCC1 |
| InChI | InChI=1S/C15H32OSi/c1-13(2)14(3,4)17(5,6)12-15(16)10-8-7-9-11-15/h13,16H,7-12H2,1-6H3 |
| InChIKey | NHBDDYGHIHDZBA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.51 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|