C20H31BrN2 — CID 130241456
(2S)-3-(5-bromocyclohex-2-en-1-yl)-2-cyclohexyl-5-methyl-1,2,3a,4,7,7a-hexahydrobenzimidazole (PubChem CID 130241456) has the molecular formula C20H31BrN2 and a molecular weight of 379.39 g/mol. Its IUPAC name is (2S)-3-(5-bromocyclohex-2-en-1-yl)-2-cyclohexyl-5-methyl-1,2,3a,4,7,7a-hexahydrobenzimidazole.
| Compound Name | (2S)-3-(5-bromocyclohex-2-en-1-yl)-2-cyclohexyl-5-methyl-1,2,3a,4,7,7a-hexahydrobenzimidazole |
|---|---|
| PubChem CID | 130241456 |
| Molecular Formula | C20H31BrN2 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (2S)-3-(5-bromocyclohex-2-en-1-yl)-2-cyclohexyl-5-methyl-1,2,3a,4,7,7a-hexahydrobenzimidazole |
| SMILES | CC1=CCC2N[C@H](C3CCCCC3)N(C3C=CCC(Br)C3)C2C1 |
| InChI | InChI=1S/C20H31BrN2/c1-14-10-11-18-19(12-14)23(17-9-5-8-16(21)13-17)20(22-18)15-6-3-2-4-7-15/h5,9-10,15-20,22H,2-4,6-8,11-13H2,1H3/t16?,17?,18?,19?,20-/m0/s1 |
| InChIKey | MAJSMJJXMUAWGO-CEVCPLMDSA-N |
| XLogP | 4.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|