C18H30N2 — CID 142939400
1-(5-methylcyclohepta-2,5-dien-1-yl)-4-piperidin-1-ylpiperidine (PubChem CID 142939400) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-(5-methylcyclohepta-2,5-dien-1-yl)-4-piperidin-1-ylpiperidine.
| Compound Name | 1-(5-methylcyclohepta-2,5-dien-1-yl)-4-piperidin-1-ylpiperidine |
|---|---|
| PubChem CID | 142939400 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 1-(5-methylcyclohepta-2,5-dien-1-yl)-4-piperidin-1-ylpiperidine |
| SMILES | CC1=CCC(N2CCC(N3CCCCC3)CC2)C=CC1 |
| InChI | InChI=1S/C18H30N2/c1-16-6-5-7-17(9-8-16)20-14-10-18(11-15-20)19-12-3-2-4-13-19/h5,7-8,17-18H,2-4,6,9-15H2,1H3 |
| InChIKey | BBBOXBYKLRNIPX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|