C29H40N2O8 — CID 130242364
(9R,11R)-9-methoxy-1,5,7,9,11-pentamethyl-4,6,12,16-tetraoxo-N'-phenylmethoxy-3,17-dioxabicyclo[12.3.0]heptadecane-15-carboximidamide (PubChem CID 130242364) has the molecular formula C29H40N2O8 and a molecular weight of 544.65 g/mol. Its IUPAC name is (9R,11R)-9-methoxy-1,5,7,9,11-pentamethyl-4,6,12,16-tetraoxo-N'-phenylmethoxy-3,17-dioxabicyclo[12.3.0]heptadecane-15-carboximidamide.
| Compound Name | (9R,11R)-9-methoxy-1,5,7,9,11-pentamethyl-4,6,12,16-tetraoxo-N'-phenylmethoxy-3,17-dioxabicyclo[12.3.0]heptadecane-15-carboximidamide |
|---|---|
| PubChem CID | 130242364 |
| Molecular Formula | C29H40N2O8 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.28 |
| IUPAC Name | (9R,11R)-9-methoxy-1,5,7,9,11-pentamethyl-4,6,12,16-tetraoxo-N'-phenylmethoxy-3,17-dioxabicyclo[12.3.0]heptadecane-15-carboximidamide |
| SMILES | CO[C@@]1(C)CC(C)C(=O)C(C)C(=O)OCC2(C)OC(=O)C(/C(N)=N/OCc3ccccc3)C2CC(=O)[C@H](C)C1 |
| InChI | InChI=1S/C29H40N2O8/c1-17-13-28(4,36-6)14-18(2)24(33)19(3)26(34)37-16-29(5)21(12-22(17)32)23(27(35)39-29)25(30)31-38-15-20-10-8-7-9-11-20/h7-11,17-19,21,23H,12-16H2,1-6H3,(H2,30,31)/t17-,18?,19?,21?,23?,28-,29?/m1/s1 |
| InChIKey | DZJZDPGYDBBBGX-ROPHJGENSA-N |
| XLogP | 3.20 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|