C10H18F2 — CID 130242959
(E)-2,2-difluoro-3,5,5-trimethylhept-3-ene (PubChem CID 130242959) has the molecular formula C10H18F2 and a molecular weight of 176.25 g/mol. Its IUPAC name is (E)-2,2-difluoro-3,5,5-trimethylhept-3-ene.
| Compound Name | (E)-2,2-difluoro-3,5,5-trimethylhept-3-ene |
|---|---|
| PubChem CID | 130242959 |
| Molecular Formula | C10H18F2 |
| Molecular Weight | 176.25 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | (E)-2,2-difluoro-3,5,5-trimethylhept-3-ene |
| SMILES | CCC(C)(C)/C=C(\C)C(C)(F)F |
| InChI | InChI=1S/C10H18F2/c1-6-9(3,4)7-8(2)10(5,11)12/h7H,6H2,1-5H3/b8-7+ |
| InChIKey | KPMPIIPDVWPQSH-BQYQJAHWSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.25 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|