C16H28O — CID 58289219
(4Z,6Z)-3,3,9,9-tetramethyl-8-methylideneundeca-4,6-dien-5-ol (PubChem CID 58289219) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (4Z,6Z)-3,3,9,9-tetramethyl-8-methylideneundeca-4,6-dien-5-ol.
| Compound Name | (4Z,6Z)-3,3,9,9-tetramethyl-8-methylideneundeca-4,6-dien-5-ol |
|---|---|
| PubChem CID | 58289219 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (4Z,6Z)-3,3,9,9-tetramethyl-8-methylideneundeca-4,6-dien-5-ol |
| SMILES | C=C(/C=C\C(O)=C\C(C)(C)CC)C(C)(C)CC |
| InChI | InChI=1S/C16H28O/c1-8-15(4,5)12-14(17)11-10-13(3)16(6,7)9-2/h10-12,17H,3,8-9H2,1-2,4-7H3/b11-10-,14-12- |
| InChIKey | LNGIIKIQLWKFIL-QDUUWUCGSA-N |
| XLogP | 5.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|