C17H27F2N — CID 130243080
3-(4-ethyl-2,3-difluorophenyl)-N,N-dipropylpropan-1-amine (PubChem CID 130243080) has the molecular formula C17H27F2N and a molecular weight of 283.41 g/mol. Its IUPAC name is 3-(4-ethyl-2,3-difluorophenyl)-N,N-dipropylpropan-1-amine.
| Compound Name | 3-(4-ethyl-2,3-difluorophenyl)-N,N-dipropylpropan-1-amine |
|---|---|
| PubChem CID | 130243080 |
| Molecular Formula | C17H27F2N |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 3-(4-ethyl-2,3-difluorophenyl)-N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CCCc1ccc(CC)c(F)c1F |
| InChI | InChI=1S/C17H27F2N/c1-4-11-20(12-5-2)13-7-8-15-10-9-14(6-3)16(18)17(15)19/h9-10H,4-8,11-13H2,1-3H3 |
| InChIKey | JEINERUSOCIASW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |