C11H16N2O4 — CID 130244816
methyl (Z)-4-oxo-4-[2-(2-oxopyrrolidin-1-yl)ethylamino]but-2-enoate (PubChem CID 130244816) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is methyl (Z)-4-oxo-4-[2-(2-oxopyrrolidin-1-yl)ethylamino]but-2-enoate.
| Compound Name | methyl (Z)-4-oxo-4-[2-(2-oxopyrrolidin-1-yl)ethylamino]but-2-enoate |
|---|---|
| PubChem CID | 130244816 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | methyl (Z)-4-oxo-4-[2-(2-oxopyrrolidin-1-yl)ethylamino]but-2-enoate |
| SMILES | COC(=O)/C=C\C(=O)NCCN1CCCC1=O |
| InChI | InChI=1S/C11H16N2O4/c1-17-11(16)5-4-9(14)12-6-8-13-7-2-3-10(13)15/h4-5H,2-3,6-8H2,1H3,(H,12,14)/b5-4- |
| InChIKey | ZRIAJRGRFQRVLI-PLNGDYQASA-N |
| XLogP | -0.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|