C10H17NO5 — CID 130253352
N-(5-hydroxy-3-propan-2-yloxy-2,7-dioxabicyclo[4.1.0]heptan-4-yl)acetamide (PubChem CID 130253352) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is N-(5-hydroxy-3-propan-2-yloxy-2,7-dioxabicyclo[4.1.0]heptan-4-yl)acetamide.
| Compound Name | N-(5-hydroxy-3-propan-2-yloxy-2,7-dioxabicyclo[4.1.0]heptan-4-yl)acetamide |
|---|---|
| PubChem CID | 130253352 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | N-(5-hydroxy-3-propan-2-yloxy-2,7-dioxabicyclo[4.1.0]heptan-4-yl)acetamide |
| SMILES | CC(=O)NC1C(OC(C)C)OC2OC2C1O |
| InChI | InChI=1S/C10H17NO5/c1-4(2)14-9-6(11-5(3)12)7(13)8-10(15-8)16-9/h4,6-10,13H,1-3H3,(H,11,12) |
| InChIKey | QWVRLVCODODWBT-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|