C19H18ClF3N2O4S — CID 130254599
2-chloro-5-[(2-methoxycyclopentyl)sulfamoyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130254599) has the molecular formula C19H18ClF3N2O4S and a molecular weight of 462.88 g/mol. Its IUPAC name is 2-chloro-5-[(2-methoxycyclopentyl)sulfamoyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 2-chloro-5-[(2-methoxycyclopentyl)sulfamoyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130254599 |
| Molecular Formula | C19H18ClF3N2O4S |
| Molecular Weight | 462.88 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 2-chloro-5-[(2-methoxycyclopentyl)sulfamoyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | COC1CCCC1NS(=O)(=O)c1ccc(Cl)c(C(=O)Nc2cc(F)c(F)c(F)c2)c1 |
| InChI | InChI=1S/C19H18ClF3N2O4S/c1-29-17-4-2-3-16(17)25-30(27,28)11-5-6-13(20)12(9-11)19(26)24-10-7-14(21)18(23)15(22)8-10/h5-9,16-17,25H,2-4H2,1H3,(H,24,26) |
| InChIKey | ANCQTPAVWWDHGS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.88 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|