About (2R)-2-[(2-tert-butyl-1,3-thiazol-5-yl)methoxy]-2-phenylethanamine
(2R)-2-[(2-tert-butyl-1,3-thiazol-5-yl)methoxy]-2-phenylethanamine (PubChem CID 130254631) has the molecular formula C16H22N2OS
and a molecular weight of 290.43 g/mol. Its IUPAC name is (2R)-2-[(2-tert-butyl-1,3-thiazol-5-yl)methoxy]-2-phenylethanamine.
Molecular Properties
| Compound Name | (2R)-2-[(2-tert-butyl-1,3-thiazol-5-yl)methoxy]-2-phenylethanamine |
| PubChem CID | 130254631 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (2R)-2-[(2-tert-butyl-1,3-thiazol-5-yl)methoxy]-2-phenylethanamine |
| SMILES | CC(C)(C)c1ncc(CO[C@@H](CN)c2ccccc2)s1 |
| InChI | InChI=1S/C16H22N2OS/c1-16(2,3)15-18-10-13(20-15)11-19-14(9-17)12-7-5-4-6-8-12/h4-8,10,14H,9,11,17H2,1-3H3/t14-/m0/s1 |
| InChIKey | ICGXAUYEYRTCBX-AWEZNQCLSA-N |
| XLogP | 3.66 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-[(2-tert-butyl-1,3-thiazol-5-yl)methoxy]-2-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(2-tert-butyl-1,3-thiazol-5-yl)methoxy]-2-phenylethanamine?
The IUPAC name of (2R)-2-[(2-tert-butyl-1,3-thiazol-5-yl)methoxy]-2-phenylethanamine (CID 130254631) is (2R)-2-[(2-tert-butyl-1,3-thiazol-5-yl)methoxy]-2-phenylethanamine.
What is the SMILES notation for (2R)-2-[(2-tert-butyl-1,3-thiazol-5-yl)methoxy]-2-phenylethanamine?
The canonical SMILES for (2R)-2-[(2-tert-butyl-1,3-thiazol-5-yl)methoxy]-2-phenylethanamine is CC(C)(C)c1ncc(CO[C@@H](CN)c2ccccc2)s1.
What is the InChIKey of (2R)-2-[(2-tert-butyl-1,3-thiazol-5-yl)methoxy]-2-phenylethanamine?
The InChIKey is ICGXAUYEYRTCBX-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H22N2OS/c1-16(2,3)15-18-10-13(20-15)11-19-14(9-17)12-7-5-4-6-8-12/h4-8,10,14H,9,11,17H2,1-3H3/t14-/m0/s1.
What are the key properties of (2R)-2-[(2-tert-butyl-1,3-thiazol-5-yl)methoxy]-2-phenylethanamine?
(2R)-2-[(2-tert-butyl-1,3-thiazol-5-yl)methoxy]-2-phenylethanamine has a molecular weight of 290.43 g/mol, XLogP of 3.66, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(2-tert-butyl-1,3-thiazol-5-yl)methoxy]-2-phenylethanamine is sourced from PubChem (CID 130254631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).