C23H32N2O2+2 — CID 130261098
[4-[[4-[dimethyl(oxiran-2-ylmethyl)azaniumyl]phenyl]methyl]phenyl]-dimethyl-(oxiran-2-ylmethyl)azanium (PubChem CID 130261098) has the molecular formula C23H32N2O2+2 and a molecular weight of 368.52 g/mol. Its IUPAC name is [4-[[4-[dimethyl(oxiran-2-ylmethyl)azaniumyl]phenyl]methyl]phenyl]-dimethyl-(oxiran-2-ylmethyl)azanium.
| Compound Name | [4-[[4-[dimethyl(oxiran-2-ylmethyl)azaniumyl]phenyl]methyl]phenyl]-dimethyl-(oxiran-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 130261098 |
| Molecular Formula | C23H32N2O2+2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | [4-[[4-[dimethyl(oxiran-2-ylmethyl)azaniumyl]phenyl]methyl]phenyl]-dimethyl-(oxiran-2-ylmethyl)azanium |
| SMILES | C[N+](C)(CC1CO1)c1ccc(Cc2ccc([N+](C)(C)CC3CO3)cc2)cc1 |
| InChI | InChI=1S/C23H32N2O2/c1-24(2,14-22-16-26-22)20-9-5-18(6-10-20)13-19-7-11-21(12-8-19)25(3,4)15-23-17-27-23/h5-12,22-23H,13-17H2,1-4H3/q+2 |
| InChIKey | CZCQTOWJTOCNSH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|