C25H32N2O4 — CID 126552700
1-[4-[[4-[bis(oxiran-2-ylmethyl)amino]phenyl]methyl]-N-(oxiran-2-ylmethyl)anilino]propan-2-ol (PubChem CID 126552700) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is 1-[4-[[4-[bis(oxiran-2-ylmethyl)amino]phenyl]methyl]-N-(oxiran-2-ylmethyl)anilino]propan-2-ol.
| Compound Name | 1-[4-[[4-[bis(oxiran-2-ylmethyl)amino]phenyl]methyl]-N-(oxiran-2-ylmethyl)anilino]propan-2-ol |
|---|---|
| PubChem CID | 126552700 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 1-[4-[[4-[bis(oxiran-2-ylmethyl)amino]phenyl]methyl]-N-(oxiran-2-ylmethyl)anilino]propan-2-ol |
| SMILES | CC(O)CN(CC1CO1)c1ccc(Cc2ccc(N(CC3CO3)CC3CO3)cc2)cc1 |
| InChI | InChI=1S/C25H32N2O4/c1-18(28)11-26(12-23-15-29-23)21-6-2-19(3-7-21)10-20-4-8-22(9-5-20)27(13-24-16-30-24)14-25-17-31-25/h2-9,18,23-25,28H,10-17H2,1H3 |
| InChIKey | VCAFZTRFVMZYOO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|