C38H64N8O4 — CID 157321079
1-(N-(2-hydroxy-3-piperazin-1-ylpropyl)-4-methylanilino)-3-piperazin-1-ylpropan-2-ol;4-methyl-N,N-bis(oxiran-2-ylmethyl)aniline;piperazine (PubChem CID 157321079) has the molecular formula C38H64N8O4 and a molecular weight of 696.98 g/mol. Its IUPAC name is 1-(N-(2-hydroxy-3-piperazin-1-ylpropyl)-4-methylanilino)-3-piperazin-1-ylpropan-2-ol;4-methyl-N,N-bis(oxiran-2-ylmethyl)aniline;piperazine.
| Compound Name | 1-(N-(2-hydroxy-3-piperazin-1-ylpropyl)-4-methylanilino)-3-piperazin-1-ylpropan-2-ol;4-methyl-N,N-bis(oxiran-2-ylmethyl)aniline;piperazine |
|---|---|
| PubChem CID | 157321079 |
| Molecular Formula | C38H64N8O4 |
| Molecular Weight | 696.98 g/mol |
| Exact Mass | 696.51 |
| IUPAC Name | 1-(N-(2-hydroxy-3-piperazin-1-ylpropyl)-4-methylanilino)-3-piperazin-1-ylpropan-2-ol;4-methyl-N,N-bis(oxiran-2-ylmethyl)aniline;piperazine |
| SMILES | C1CNCCN1.Cc1ccc(N(CC(O)CN2CCNCC2)CC(O)CN2CCNCC2)cc1.Cc1ccc(N(CC2CO2)CC2CO2)cc1 |
| InChI | InChI=1S/C21H37N5O2.C13H17NO2.C4H10N2/c1-18-2-4-19(5-3-18)26(16-20(27)14-24-10-6-22-7-11-24)17-21(28)15-25-12-8-23-9-13-25;1-10-2-4-11(5-3-10)14(6-12-8-15-12)7-13-9-16-13;1-2-6-4-3-5-1/h2-5,20-23,27-28H,6-17H2,1H3;2-5,12-13H,6-9H2,1H3;5-6H,1-4H2 |
| InChIKey | BEEAQQVORYFTFU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 126.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.98 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|