C26H33N3O3 — CID 160947360
1-[4-[[4-[cyclopropylmethyl(oxiran-2-ylmethyl)amino]phenyl]methyl]phenyl]-3-ethyl-1-(oxiran-2-ylmethyl)urea (PubChem CID 160947360) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 1-[4-[[4-[cyclopropylmethyl(oxiran-2-ylmethyl)amino]phenyl]methyl]phenyl]-3-ethyl-1-(oxiran-2-ylmethyl)urea.
| Compound Name | 1-[4-[[4-[cyclopropylmethyl(oxiran-2-ylmethyl)amino]phenyl]methyl]phenyl]-3-ethyl-1-(oxiran-2-ylmethyl)urea |
|---|---|
| PubChem CID | 160947360 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 1-[4-[[4-[cyclopropylmethyl(oxiran-2-ylmethyl)amino]phenyl]methyl]phenyl]-3-ethyl-1-(oxiran-2-ylmethyl)urea |
| SMILES | CCNC(=O)N(CC1CO1)c1ccc(Cc2ccc(N(CC3CC3)CC3CO3)cc2)cc1 |
| InChI | InChI=1S/C26H33N3O3/c1-2-27-26(30)29(16-25-18-32-25)23-11-7-20(8-12-23)13-19-5-9-22(10-6-19)28(14-21-3-4-21)15-24-17-31-24/h5-12,21,24-25H,2-4,13-18H2,1H3,(H,27,30) |
| InChIKey | GUELAQLOVVOBLD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 60.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|