C49H29N5O2 — CID 130262571
2-[3-[6-[3,5-di(dibenzofuran-2-yl)phenyl]-2-phenylpyrimidin-4-yl]phenyl]-1,3,5-triazine (PubChem CID 130262571) has the molecular formula C49H29N5O2 and a molecular weight of 719.80 g/mol. Its IUPAC name is 2-[3-[6-[3,5-di(dibenzofuran-2-yl)phenyl]-2-phenylpyrimidin-4-yl]phenyl]-1,3,5-triazine.
| Compound Name | 2-[3-[6-[3,5-di(dibenzofuran-2-yl)phenyl]-2-phenylpyrimidin-4-yl]phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 130262571 |
| Molecular Formula | C49H29N5O2 |
| Molecular Weight | 719.80 g/mol |
| Exact Mass | 719.23 |
| IUPAC Name | 2-[3-[6-[3,5-di(dibenzofuran-2-yl)phenyl]-2-phenylpyrimidin-4-yl]phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3cc(-c4ccc5oc6ccccc6c5c4)cc(-c4ccc5oc6ccccc6c5c4)c3)cc(-c3cccc(-c4ncncn4)c3)n2)cc1 |
| InChI | InChI=1S/C49H29N5O2/c1-2-9-30(10-3-1)49-53-42(33-11-8-12-34(21-33)48-51-28-50-29-52-48)27-43(54-49)37-23-35(31-17-19-46-40(25-31)38-13-4-6-15-44(38)55-46)22-36(24-37)32-18-20-47-41(26-32)39-14-5-7-16-45(39)56-47/h1-29H |
| InChIKey | VOSBPPWBXJPKDT-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.80 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |