C37H21N5 — CID 130264404
4-[4-pyren-1-yl-6-(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 130264404) has the molecular formula C37H21N5 and a molecular weight of 535.61 g/mol. Its IUPAC name is 4-[4-pyren-1-yl-6-(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 4-[4-pyren-1-yl-6-(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 130264404 |
| Molecular Formula | C37H21N5 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 4-[4-pyren-1-yl-6-(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nc(-c3ccc(-c4ccncc4)cc3)nc(-c3ccc4ccc5cccc6ccc3c4c56)n2)cc1 |
| InChI | InChI=1S/C37H21N5/c38-22-23-4-6-29(7-5-23)35-40-36(30-12-8-24(9-13-30)25-18-20-39-21-19-25)42-37(41-35)32-17-15-28-11-10-26-2-1-3-27-14-16-31(32)34(28)33(26)27/h1-21H |
| InChIKey | FXXFDHYZFXCYIY-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|