C60H34N12 — CID 146230735
5-[4-[6-[4,6-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]pyren-1-yl]-6-quinoxalin-5-yl-1,3,5-triazin-2-yl]quinoxaline (PubChem CID 146230735) has the molecular formula C60H34N12 and a molecular weight of 923.02 g/mol. Its IUPAC name is 5-[4-[6-[4,6-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]pyren-1-yl]-6-quinoxalin-5-yl-1,3,5-triazin-2-yl]quinoxaline.
| Compound Name | 5-[4-[6-[4,6-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]pyren-1-yl]-6-quinoxalin-5-yl-1,3,5-triazin-2-yl]quinoxaline |
|---|---|
| PubChem CID | 146230735 |
| Molecular Formula | C60H34N12 |
| Molecular Weight | 923.02 g/mol |
| Exact Mass | 922.30 |
| IUPAC Name | 5-[4-[6-[4,6-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]pyren-1-yl]-6-quinoxalin-5-yl-1,3,5-triazin-2-yl]quinoxaline |
| SMILES | c1cc(-c2nc(-c3ccc4ccc5c(-c6nc(-c7ccc(-c8ccncc8)cc7)nc(-c7ccc(-c8ccncc8)cc7)n6)ccc6ccc3c4c65)nc(-c3cccc4nccnc34)n2)c2nccnc2c1 |
| InChI | InChI=1S/C60H34N12/c1-3-47(53-49(5-1)63-31-33-65-53)59-70-58(71-60(72-59)48-4-2-6-50-54(48)66-34-32-64-50)46-22-18-40-15-19-43-45(21-17-39-16-20-44(46)52(40)51(39)43)57-68-55(41-11-7-35(8-12-41)37-23-27-61-28-24-37)67-56(69-57)42-13-9-36(10-14-42)38-25-29-62-30-26-38/h1-34H |
| InChIKey | XVQAICUKLODBCM-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 154.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.02 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|