C18H24N2 — CID 130265724
9-propan-2-yl-9,12-diazatetracyclo[10.3.2.02,10.03,8]heptadeca-2(10),3,5,7-tetraene (PubChem CID 130265724) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 9-propan-2-yl-9,12-diazatetracyclo[10.3.2.02,10.03,8]heptadeca-2(10),3,5,7-tetraene.
| Compound Name | 9-propan-2-yl-9,12-diazatetracyclo[10.3.2.02,10.03,8]heptadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 130265724 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 9-propan-2-yl-9,12-diazatetracyclo[10.3.2.02,10.03,8]heptadeca-2(10),3,5,7-tetraene |
| SMILES | CC(C)n1c2c(c3ccccc31)C1CCCN(CC1)C2 |
| InChI | InChI=1S/C18H24N2/c1-13(2)20-16-8-4-3-7-15(16)18-14-6-5-10-19(11-9-14)12-17(18)20/h3-4,7-8,13-14H,5-6,9-12H2,1-2H3 |
| InChIKey | IBAOAUUVMDQCTJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |