C14H21F3OS — CID 130269106
2,5-ditert-butyl-3-(2,2,2-trifluoroethoxy)thiophene (PubChem CID 130269106) has the molecular formula C14H21F3OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 2,5-ditert-butyl-3-(2,2,2-trifluoroethoxy)thiophene.
| Compound Name | 2,5-ditert-butyl-3-(2,2,2-trifluoroethoxy)thiophene |
|---|---|
| PubChem CID | 130269106 |
| Molecular Formula | C14H21F3OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2,5-ditert-butyl-3-(2,2,2-trifluoroethoxy)thiophene |
| SMILES | CC(C)(C)c1cc(OCC(F)(F)F)c(C(C)(C)C)s1 |
| InChI | InChI=1S/C14H21F3OS/c1-12(2,3)10-7-9(18-8-14(15,16)17)11(19-10)13(4,5)6/h7H,8H2,1-6H3 |
| InChIKey | LMRSDWOHYQXERA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |