C27H37NO4 — CID 130271529
1-[(2S,3S,4S)-4-[3-(2-methoxyethoxy)phenyl]-1-[(4-methoxyphenyl)methyl]-2-methylpiperidin-3-yl]butan-1-one (PubChem CID 130271529) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is 1-[(2S,3S,4S)-4-[3-(2-methoxyethoxy)phenyl]-1-[(4-methoxyphenyl)methyl]-2-methylpiperidin-3-yl]butan-1-one.
| Compound Name | 1-[(2S,3S,4S)-4-[3-(2-methoxyethoxy)phenyl]-1-[(4-methoxyphenyl)methyl]-2-methylpiperidin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 130271529 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 1-[(2S,3S,4S)-4-[3-(2-methoxyethoxy)phenyl]-1-[(4-methoxyphenyl)methyl]-2-methylpiperidin-3-yl]butan-1-one |
| SMILES | CCCC(=O)[C@H]1[C@@H](c2cccc(OCCOC)c2)CCN(Cc2ccc(OC)cc2)[C@H]1C |
| InChI | InChI=1S/C27H37NO4/c1-5-7-26(29)27-20(2)28(19-21-10-12-23(31-4)13-11-21)15-14-25(27)22-8-6-9-24(18-22)32-17-16-30-3/h6,8-13,18,20,25,27H,5,7,14-17,19H2,1-4H3/t20-,25+,27+/m0/s1 |
| InChIKey | RCRHVRIYAGEYTH-FBQMUFCQSA-N |
| XLogP | 5.08 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|