C23H35NO6 — CID 170266741
tert-butyl (2R,3S,4R)-3-(acetyloxymethyl)-4-[3-(2-methoxyethoxy)phenyl]-2-methylpiperidine-1-carboxylate (PubChem CID 170266741) has the molecular formula C23H35NO6 and a molecular weight of 421.53 g/mol. Its IUPAC name is tert-butyl (2R,3S,4R)-3-(acetyloxymethyl)-4-[3-(2-methoxyethoxy)phenyl]-2-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S,4R)-3-(acetyloxymethyl)-4-[3-(2-methoxyethoxy)phenyl]-2-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 170266741 |
| Molecular Formula | C23H35NO6 |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | tert-butyl (2R,3S,4R)-3-(acetyloxymethyl)-4-[3-(2-methoxyethoxy)phenyl]-2-methylpiperidine-1-carboxylate |
| SMILES | COCCOc1cccc([C@@H]2CCN(C(=O)OC(C)(C)C)[C@H](C)[C@H]2COC(C)=O)c1 |
| InChI | InChI=1S/C23H35NO6/c1-16-21(15-29-17(2)25)20(10-11-24(16)22(26)30-23(3,4)5)18-8-7-9-19(14-18)28-13-12-27-6/h7-9,14,16,20-21H,10-13,15H2,1-6H3/t16-,20+,21-/m1/s1 |
| InChIKey | HCDSVHAPUKXFDK-TYCQWZJGSA-N |
| XLogP | 4.00 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|