C19H26F3NO6S — CID 126676944
tert-butyl (2R,3S,4R)-3-(hydroxymethyl)-2-methyl-4-[3-(trifluoromethylsulfonyloxy)phenyl]piperidine-1-carboxylate (PubChem CID 126676944) has the molecular formula C19H26F3NO6S and a molecular weight of 453.48 g/mol. Its IUPAC name is tert-butyl (2R,3S,4R)-3-(hydroxymethyl)-2-methyl-4-[3-(trifluoromethylsulfonyloxy)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S,4R)-3-(hydroxymethyl)-2-methyl-4-[3-(trifluoromethylsulfonyloxy)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 126676944 |
| Molecular Formula | C19H26F3NO6S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | tert-butyl (2R,3S,4R)-3-(hydroxymethyl)-2-methyl-4-[3-(trifluoromethylsulfonyloxy)phenyl]piperidine-1-carboxylate |
| SMILES | C[C@@H]1[C@@H](CO)[C@H](c2cccc(OS(=O)(=O)C(F)(F)F)c2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26F3NO6S/c1-12-16(11-24)15(8-9-23(12)17(25)28-18(2,3)4)13-6-5-7-14(10-13)29-30(26,27)19(20,21)22/h5-7,10,12,15-16,24H,8-9,11H2,1-4H3/t12-,15+,16-/m1/s1 |
| InChIKey | CQMVYGCNFDVODG-UHOFOFEASA-N |
| XLogP | 3.64 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|