C12H12N2O2 — CID 13027273
1-methyl-2-(3-methylphenyl)pyridazine-3,6-dione (PubChem CID 13027273) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 1-methyl-2-(3-methylphenyl)pyridazine-3,6-dione.
| Compound Name | 1-methyl-2-(3-methylphenyl)pyridazine-3,6-dione |
|---|---|
| PubChem CID | 13027273 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-methyl-2-(3-methylphenyl)pyridazine-3,6-dione |
| SMILES | Cc1cccc(-n2c(=O)ccc(=O)n2C)c1 |
| InChI | InChI=1S/C12H12N2O2/c1-9-4-3-5-10(8-9)14-12(16)7-6-11(15)13(14)2/h3-8H,1-2H3 |
| InChIKey | PPPWJFHXGAEZSF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |