C17H17N3O3S — CID 21454850
4-methoxy-2,6-bis(3-methylphenyl)-1,2,4,6-thiatriazinane-3,5-dione (PubChem CID 21454850) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 4-methoxy-2,6-bis(3-methylphenyl)-1,2,4,6-thiatriazinane-3,5-dione.
| Compound Name | 4-methoxy-2,6-bis(3-methylphenyl)-1,2,4,6-thiatriazinane-3,5-dione |
|---|---|
| PubChem CID | 21454850 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 4-methoxy-2,6-bis(3-methylphenyl)-1,2,4,6-thiatriazinane-3,5-dione |
| SMILES | CON1C(=O)N(c2cccc(C)c2)SN(c2cccc(C)c2)C1=O |
| InChI | InChI=1S/C17H17N3O3S/c1-12-6-4-8-14(10-12)19-16(21)18(23-3)17(22)20(24-19)15-9-5-7-13(2)11-15/h4-11H,1-3H3 |
| InChIKey | HNDDMXWTFKCXOQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|