C21H20N2O4 — CID 130275279
2-amino-7-[(E)-2-cyclohexylethenyl]-5-oxochromeno[2,3-b]pyridine-3-carboxylic acid (PubChem CID 130275279) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-amino-7-[(E)-2-cyclohexylethenyl]-5-oxochromeno[2,3-b]pyridine-3-carboxylic acid.
| Compound Name | 2-amino-7-[(E)-2-cyclohexylethenyl]-5-oxochromeno[2,3-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 130275279 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-amino-7-[(E)-2-cyclohexylethenyl]-5-oxochromeno[2,3-b]pyridine-3-carboxylic acid |
| SMILES | Nc1nc2oc3ccc(/C=C/C4CCCCC4)cc3c(=O)c2cc1C(=O)O |
| InChI | InChI=1S/C21H20N2O4/c22-19-16(21(25)26)11-15-18(24)14-10-13(7-6-12-4-2-1-3-5-12)8-9-17(14)27-20(15)23-19/h6-12H,1-5H2,(H2,22,23)(H,25,26)/b7-6+ |
| InChIKey | MIFSMGYHBAGPNQ-VOTSOKGWSA-N |
| XLogP | 4.22 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|