C11H15ClN2O2 — CID 130275786
2-(4-amino-2-chloro-3-methoxyphenyl)-N,N-dimethylacetamide (PubChem CID 130275786) has the molecular formula C11H15ClN2O2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 2-(4-amino-2-chloro-3-methoxyphenyl)-N,N-dimethylacetamide.
| Compound Name | 2-(4-amino-2-chloro-3-methoxyphenyl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 130275786 |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-(4-amino-2-chloro-3-methoxyphenyl)-N,N-dimethylacetamide |
| SMILES | COc1c(N)ccc(CC(=O)N(C)C)c1Cl |
| InChI | InChI=1S/C11H15ClN2O2/c1-14(2)9(15)6-7-4-5-8(13)11(16-3)10(7)12/h4-5H,6,13H2,1-3H3 |
| InChIKey | HRUBDRCMIVBIOG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|