C11H15ClN2O — CID 130276926
2-(4-amino-2-chloro-5-methylphenyl)-N,N-dimethylacetamide (PubChem CID 130276926) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is 2-(4-amino-2-chloro-5-methylphenyl)-N,N-dimethylacetamide.
| Compound Name | 2-(4-amino-2-chloro-5-methylphenyl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 130276926 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-(4-amino-2-chloro-5-methylphenyl)-N,N-dimethylacetamide |
| SMILES | Cc1cc(CC(=O)N(C)C)c(Cl)cc1N |
| InChI | InChI=1S/C11H15ClN2O/c1-7-4-8(5-11(15)14(2)3)9(12)6-10(7)13/h4,6H,5,13H2,1-3H3 |
| InChIKey | HPRYWFOQDAJLAN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|