C11H17ClN2O2 — CID 166541260
2-(3-amino-2-methoxyphenyl)-N,N-dimethylacetamide;hydrochloride (PubChem CID 166541260) has the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. Its IUPAC name is 2-(3-amino-2-methoxyphenyl)-N,N-dimethylacetamide;hydrochloride.
| Compound Name | 2-(3-amino-2-methoxyphenyl)-N,N-dimethylacetamide;hydrochloride |
|---|---|
| PubChem CID | 166541260 |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-(3-amino-2-methoxyphenyl)-N,N-dimethylacetamide;hydrochloride |
| SMILES | COc1c(N)cccc1CC(=O)N(C)C.Cl |
| InChI | InChI=1S/C11H16N2O2.ClH/c1-13(2)10(14)7-8-5-4-6-9(12)11(8)15-3;/h4-6H,7,12H2,1-3H3;1H |
| InChIKey | STVKRXWIFBVOSD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|