C12H10F6N2O2 — CID 130277544
4-(2,2,3-trifluorobutanoyl)-2-(trifluoromethyl)benzohydrazide (PubChem CID 130277544) has the molecular formula C12H10F6N2O2 and a molecular weight of 328.21 g/mol. Its IUPAC name is 4-(2,2,3-trifluorobutanoyl)-2-(trifluoromethyl)benzohydrazide.
| Compound Name | 4-(2,2,3-trifluorobutanoyl)-2-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 130277544 |
| Molecular Formula | C12H10F6N2O2 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 4-(2,2,3-trifluorobutanoyl)-2-(trifluoromethyl)benzohydrazide |
| SMILES | CC(F)C(F)(F)C(=O)c1ccc(C(=O)NN)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H10F6N2O2/c1-5(13)11(14,15)9(21)6-2-3-7(10(22)20-19)8(4-6)12(16,17)18/h2-5H,19H2,1H3,(H,20,22) |
| InChIKey | YJSWXAZSEJPEPI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|