C12H12F3NO4 — CID 167943337
4-(propoxycarbamoyl)-3-(trifluoromethyl)benzoic acid (PubChem CID 167943337) has the molecular formula C12H12F3NO4 and a molecular weight of 291.23 g/mol. Its IUPAC name is 4-(propoxycarbamoyl)-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-(propoxycarbamoyl)-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 167943337 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 4-(propoxycarbamoyl)-3-(trifluoromethyl)benzoic acid |
| SMILES | CCCONC(=O)c1ccc(C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO4/c1-2-5-20-16-10(17)8-4-3-7(11(18)19)6-9(8)12(13,14)15/h3-4,6H,2,5H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | QJXAEKVXNYJNOP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|