C24H26ClN5O6 — CID 130278272
(2E)-3-[3-[(4-chlorophenyl)methyl]-4-(3-methyl-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazin-1-yl]-2-methoxyiminopropanoic acid (PubChem CID 130278272) has the molecular formula C24H26ClN5O6 and a molecular weight of 515.95 g/mol. Its IUPAC name is (2E)-3-[3-[(4-chlorophenyl)methyl]-4-(3-methyl-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazin-1-yl]-2-methoxyiminopropanoic acid.
| Compound Name | (2E)-3-[3-[(4-chlorophenyl)methyl]-4-(3-methyl-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazin-1-yl]-2-methoxyiminopropanoic acid |
|---|---|
| PubChem CID | 130278272 |
| Molecular Formula | C24H26ClN5O6 |
| Molecular Weight | 515.95 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | (2E)-3-[3-[(4-chlorophenyl)methyl]-4-(3-methyl-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazin-1-yl]-2-methoxyiminopropanoic acid |
| SMILES | CO/N=C(\Cn1c(=O)nc(Nc2ccc(OC(C)C)c(C)c2)n(Cc2ccc(Cl)cc2)c1=O)C(=O)O |
| InChI | InChI=1S/C24H26ClN5O6/c1-14(2)36-20-10-9-18(11-15(20)3)26-22-27-23(33)30(13-19(21(31)32)28-35-4)24(34)29(22)12-16-5-7-17(25)8-6-16/h5-11,14H,12-13H2,1-4H3,(H,31,32)(H,26,27,33)/b28-19+ |
| InChIKey | WHJAZEPHUXUGSM-TURZUDJPSA-N |
| XLogP | 3.03 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.95 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|