C25H27ClFN5O6 — CID 86689111
ethyl 3-[3-[(4-chlorophenyl)methyl]-4-(3-fluoro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazin-1-yl]-2-methoxyiminopropanoate (PubChem CID 86689111) has the molecular formula C25H27ClFN5O6 and a molecular weight of 547.97 g/mol. Its IUPAC name is ethyl 3-[3-[(4-chlorophenyl)methyl]-4-(3-fluoro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazin-1-yl]-2-methoxyiminopropanoate.
| Compound Name | ethyl 3-[3-[(4-chlorophenyl)methyl]-4-(3-fluoro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazin-1-yl]-2-methoxyiminopropanoate |
|---|---|
| PubChem CID | 86689111 |
| Molecular Formula | C25H27ClFN5O6 |
| Molecular Weight | 547.97 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | ethyl 3-[3-[(4-chlorophenyl)methyl]-4-(3-fluoro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazin-1-yl]-2-methoxyiminopropanoate |
| SMILES | CCOC(=O)C(Cn1c(=O)nc(Nc2ccc(OC(C)C)c(F)c2)n(Cc2ccc(Cl)cc2)c1=O)=NOC |
| InChI | InChI=1S/C25H27ClFN5O6/c1-5-37-22(33)20(30-36-4)14-32-24(34)29-23(28-18-10-11-21(19(27)12-18)38-15(2)3)31(25(32)35)13-16-6-8-17(26)9-7-16/h6-12,15H,5,13-14H2,1-4H3,(H,28,29,34) |
| InChIKey | YIGJBVSOWOYXIM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.97 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|