C25H30N4O5 — CID 130278488
3-[3-[(4-methylphenyl)methyl]-2,6-dioxo-4-(4-pentoxyanilino)-1,3,5-triazin-1-yl]propanoic acid (PubChem CID 130278488) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is 3-[3-[(4-methylphenyl)methyl]-2,6-dioxo-4-(4-pentoxyanilino)-1,3,5-triazin-1-yl]propanoic acid.
| Compound Name | 3-[3-[(4-methylphenyl)methyl]-2,6-dioxo-4-(4-pentoxyanilino)-1,3,5-triazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 130278488 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 3-[3-[(4-methylphenyl)methyl]-2,6-dioxo-4-(4-pentoxyanilino)-1,3,5-triazin-1-yl]propanoic acid |
| SMILES | CCCCCOc1ccc(Nc2nc(=O)n(CCC(=O)O)c(=O)n2Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H30N4O5/c1-3-4-5-16-34-21-12-10-20(11-13-21)26-23-27-24(32)28(15-14-22(30)31)25(33)29(23)17-19-8-6-18(2)7-9-19/h6-13H,3-5,14-17H2,1-2H3,(H,30,31)(H,26,27,32) |
| InChIKey | FSTUZRGCAFRWRF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|