C10H14N2 — CID 130278940
(2Z,4Z,6E)-N,6-dimethyl-N'-methylidenehepta-2,4,6-triene-1,7-diimine (PubChem CID 130278940) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (2Z,4Z,6E)-N,6-dimethyl-N'-methylidenehepta-2,4,6-triene-1,7-diimine.
| Compound Name | (2Z,4Z,6E)-N,6-dimethyl-N'-methylidenehepta-2,4,6-triene-1,7-diimine |
|---|---|
| PubChem CID | 130278940 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (2Z,4Z,6E)-N,6-dimethyl-N'-methylidenehepta-2,4,6-triene-1,7-diimine |
| SMILES | C=N/C=C(C)/C=C\C=C/C=N/C |
| InChI | InChI=1S/C10H14N2/c1-10(9-12-3)7-5-4-6-8-11-2/h4-9H,3H2,1-2H3/b6-4-,7-5-,10-9+,11-8+ |
| InChIKey | YOSODEJBGZGZNW-DIAWGFHNSA-N |
| XLogP | 2.40 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|