C27H30N3O8P — CID 130280929
[(1S)-1-phenylethyl] 2-[[[(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphanyl]amino]prop-2-enoate (PubChem CID 130280929) has the molecular formula C27H30N3O8P and a molecular weight of 555.52 g/mol. Its IUPAC name is [(1S)-1-phenylethyl] 2-[[[(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphanyl]amino]prop-2-enoate.
| Compound Name | [(1S)-1-phenylethyl] 2-[[[(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphanyl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 130280929 |
| Molecular Formula | C27H30N3O8P |
| Molecular Weight | 555.52 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | [(1S)-1-phenylethyl] 2-[[[(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphanyl]amino]prop-2-enoate |
| SMILES | C=C(NP(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](C)[C@@H]1O)Oc1ccccc1)C(=O)O[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C27H30N3O8P/c1-17-24(32)22(37-25(17)30-15-14-23(31)28-27(30)34)16-35-39(38-21-12-8-5-9-13-21)29-18(2)26(33)36-19(3)20-10-6-4-7-11-20/h4-15,17,19,22,24-25,29,32H,2,16H2,1,3H3,(H,28,31,34)/t17-,19-,22+,24-,25+,39?/m0/s1 |
| InChIKey | JIBGRLQCXHSWIX-ONZOUSCESA-N |
| XLogP | 3.16 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|