C24H34N3O7P — CID 142418810
1-[(2R,3S,4S,5S)-3,4-dimethyl-5-[[phenoxy-[[(2S)-3-propan-2-yloxybut-3-en-2-yl]amino]phosphoryl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 142418810) has the molecular formula C24H34N3O7P and a molecular weight of 507.52 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5S)-3,4-dimethyl-5-[[phenoxy-[[(2S)-3-propan-2-yloxybut-3-en-2-yl]amino]phosphoryl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4S,5S)-3,4-dimethyl-5-[[phenoxy-[[(2S)-3-propan-2-yloxybut-3-en-2-yl]amino]phosphoryl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142418810 |
| Molecular Formula | C24H34N3O7P |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 1-[(2R,3S,4S,5S)-3,4-dimethyl-5-[[phenoxy-[[(2S)-3-propan-2-yloxybut-3-en-2-yl]amino]phosphoryl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=C(OC(C)C)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](C)[C@@H]1C)Oc1ccccc1 |
| InChI | InChI=1S/C24H34N3O7P/c1-15(2)32-19(6)18(5)26-35(30,34-20-10-8-7-9-11-20)31-14-21-16(3)17(4)23(33-21)27-13-12-22(28)25-24(27)29/h7-13,15-18,21,23H,6,14H2,1-5H3,(H,26,30)(H,25,28,29)/t16-,17-,18-,21+,23+,35?/m0/s1 |
| InChIKey | QRFLOBUBGORVHL-JPTZCZFJSA-N |
| XLogP | 3.83 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|