C13H25N5O3 — CID 130281989
2-[[2-(4-formylpiperazin-1-yl)-2-oxoethyl]amino]-2-methyl-N-(methylaminomethyl)propanamide (PubChem CID 130281989) has the molecular formula C13H25N5O3 and a molecular weight of 299.38 g/mol. Its IUPAC name is 2-[[2-(4-formylpiperazin-1-yl)-2-oxoethyl]amino]-2-methyl-N-(methylaminomethyl)propanamide.
| Compound Name | 2-[[2-(4-formylpiperazin-1-yl)-2-oxoethyl]amino]-2-methyl-N-(methylaminomethyl)propanamide |
|---|---|
| PubChem CID | 130281989 |
| Molecular Formula | C13H25N5O3 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 2-[[2-(4-formylpiperazin-1-yl)-2-oxoethyl]amino]-2-methyl-N-(methylaminomethyl)propanamide |
| SMILES | CNCNC(=O)C(C)(C)NCC(=O)N1CCN(C=O)CC1 |
| InChI | InChI=1S/C13H25N5O3/c1-13(2,12(21)15-9-14-3)16-8-11(20)18-6-4-17(10-19)5-7-18/h10,14,16H,4-9H2,1-3H3,(H,15,21) |
| InChIKey | AHFVUXWFUGPBNA-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|