C9H15N3O4 — CID 112991841
methyl N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]carbamate (PubChem CID 112991841) has the molecular formula C9H15N3O4 and a molecular weight of 229.24 g/mol. Its IUPAC name is methyl N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]carbamate.
| Compound Name | methyl N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 112991841 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | methyl N-[2-(4-formylpiperazin-1-yl)-2-oxoethyl]carbamate |
| SMILES | COC(=O)NCC(=O)N1CCN(C=O)CC1 |
| InChI | InChI=1S/C9H15N3O4/c1-16-9(15)10-6-8(14)12-4-2-11(7-13)3-5-12/h7H,2-6H2,1H3,(H,10,15) |
| InChIKey | YZTOUSOJNMRLMO-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|