C9H9N3O2S2 — CID 130285052
N-[5-(methoxyamino)-1,3-thiazol-2-yl]thiophene-2-carboxamide (PubChem CID 130285052) has the molecular formula C9H9N3O2S2 and a molecular weight of 255.32 g/mol. Its IUPAC name is N-[5-(methoxyamino)-1,3-thiazol-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[5-(methoxyamino)-1,3-thiazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 130285052 |
| Molecular Formula | C9H9N3O2S2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | N-[5-(methoxyamino)-1,3-thiazol-2-yl]thiophene-2-carboxamide |
| SMILES | CONc1cnc(NC(=O)c2cccs2)s1 |
| InChI | InChI=1S/C9H9N3O2S2/c1-14-12-7-5-10-9(16-7)11-8(13)6-3-2-4-15-6/h2-5,12H,1H3,(H,10,11,13) |
| InChIKey | HDDTZWATEJIMAO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|